BD0507053
5-Methyl-3-phenylisoxazole-4-carbonylchloride , 98% , 16883-16-2
CAS NO.：16883-16-2
Empirical Formula: C11H8ClNO2
Molecular Weight: 221.64
MDL number: MFCD00052205
EINECS: 240-915-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB126.40 | In Stock |
|
| 25g | RMB380.80 | In Stock |
|
| 100g | RMB1144.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24 °C |
| Boiling point: | 115-117 °C(Press: 3 Torr) |
| Density | 1.27 |
| vapor pressure | 0.007Pa at 25℃ |
| Flash point: | >100 |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -4.78±0.50(Predicted) |
| color | White to Light yellow |
| Water Solubility | 701.8mg/L at 25℃ |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C11H8ClNO2/c1-7-9(11(12)14)10(13-15-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=C(C)ON=C1C1=CC=CC=C1)=O |
| LogP | 1.97 at 25℃ |
Description and Uses
Used as Intermediate of oxacillin sodium.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xi |
| Risk Statements | 22-34-36 |
| Safety Statements | 26-36/37/39-45-26/36/37/39/45-20 |
| RIDADR | UN3261 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2934999090 |
