BD0502532
4-Amino-3-chlorophenol , 98% , 17609-80-2
CAS NO.：17609-80-2
Empirical Formula: C6H6ClNO
Molecular Weight: 143.57
MDL number: MFCD00801116
EINECS: 241-583-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB72.80 | In Stock |
|
| 10g | RMB139.20 | In Stock |
|
| 25g | RMB316.00 | In Stock |
|
| 100g | RMB1174.40 | In Stock |
|
| 500g | RMB5790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-160℃ |
| Boiling point: | 287.3±25.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| RTECS | SJ5710000 |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.26±0.18(Predicted) |
| form | Crystalline Powder |
| color | White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H6ClNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| InChIKey | PNLPXABQLXSICH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N)C(Cl)=C1 |
Description and Uses
4-Amino-3-Chlorophenol acts as a synthetic reagent for the preparation of Benzothiazole-based ureas as potential ABAD/17β-HSD10 modulators for Alzheimer''s disease treatment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | 6.1 |
| HS Code | 2922290090 |
