BD0423853
Tris(perfluoropropyl)amine , 98% , 338-83-0
CAS NO.：338-83-0
Empirical Formula: C9F21N
Molecular Weight: 521.07
MDL number: MFCD00042589
EINECS: 206-420-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB65.60 | In Stock |
|
| 100g | RMB234.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -52 °C |
| Boiling point: | 125-135°C |
| Density | 1.82 |
| vapor pressure | 5.16hPa at 20℃ |
| refractive index | 1.279 |
| storage temp. | -20°C, Inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Oil |
| pka | -27.02±0.50(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C9F21N/c10-1(11,4(16,17)18)7(25,26)31(8(27,28)2(12,13)5(19,20)21)9(29,30)3(14,15)6(22,23)24 |
| InChIKey | JAJLKEVKNDUJBG-UHFFFAOYSA-N |
| SMILES | C(F)(F)(N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| LogP | 5.3-6.1 |
Description and Uses
Perfluorotripropylamine is a reagent used in the surface modification of droplet polymeric microfluidic devices. This is used to improve the stable and continueous generation of aqueous droplets.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H317-H402 |
| Precautionary statements | P501-P261-P273-P272-P270-P264-P280-P302+P352-P362+P364-P333+P313-P301+P310+P330-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| Hazard Note | Irritant |
| TSCA | T |
| HS Code | 2921199990 |
