BD0412132
2,2-Dimethylpiperazine , 95% , 84477-72-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB59.20 | In Stock |
|
| 250mg | RMB104.80 | In Stock |
|
| 1g | RMB180.00 | In Stock |
|
| 5g | RMB558.40 | In Stock |
|
| 10g | RMB962.40 | In Stock |
|
| 25g | RMB2192.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 155.2±8.0 °C(Predicted) |
| Density | 0.833±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.38±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow Low Melting |
| InChI | InChI=1S/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3 |
| InChIKey | PIPWSBOFSUJCCO-UHFFFAOYSA-N |
| SMILES | N1CCNCC1(C)C |
Description and Uses
2,2-Dimethylpiperazine is a chemical reagent used in the preparation of non-covalent NAAA inhibitors used as a protective agent for the development of multiple sclerosis.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P310-P332+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 42-51/53 |
| Safety Statements | 61 |
| RIDADR | UN3077 |
