BD0346248
4-Amino-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-onehydrate , 95+% , 207121-53-7
Synonym(s):
Cytosine deoxyriboside
CAS NO.：207121-53-7
Empirical Formula: C9H15N3O5
Molecular Weight: 245.24
MDL number: MFCD00006547
EINECS: 213-454-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB94.40 | In Stock |
|
| 5g | RMB283.20 | In Stock |
|
| 10g | RMB555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-211 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H13N3O4.H2O/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8;/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15);1H2/t5-,6+,8+;/s3 |
| InChIKey | HXBGOHZLZCFWLH-AZXCMKNYNA-N |
| SMILES | O=C1N=C(N)C=CN1[C@H]1C[C@H](O)[C@@H](CO)O1.O |&1:8,10,12,r| |
Description and Uses
A deoxyribonucleoside as Eg5 kinesin modulator with antiproliferative and apoptosis-inducing activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| RTECS | HA3800000 |
| F | 10 |
