A8473832
2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl Methacrylate (stabilized with TBC) , 96%(totalofisomers) , 2261-99-6
CAS NO.：2261-99-6
Empirical Formula: C11H8F12O2
Molecular Weight: 400.16
MDL number: MFCD00080658
EINECS: 218-863-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB199.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| 500G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112 °C |
| Density | 1.536 |
| refractive index | 1.349 |
| Flash point: | 104 |
| storage temp. | Keep Cold |
| form | clear liquid |
| Specific Gravity | 1.536 |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C11H8F12O2/c1-4(2)5(24)25-3-7(14,15)9(18,19)11(22,23)10(20,21)8(16,17)6(12)13/h6H,1,3H2,2H3 |
| InChIKey | YJKHMSPWWGBKTN-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C(C)=C |
| CAS DataBase Reference | 2261-99-6(CAS DataBase Reference) |
| EPA Substance Registry System | (6H-Perfluorohexyl)methyl methacrylate (2261-99-6) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38-23/24/25 |
| Safety Statements | 26-36/37/39-28 |
| RIDADR | 2810 |
| HazardClass | IRRITANT |
| HS Code | 29161400 |
