A8431932
Closantel Sodium , ≥98% , 61438-64-0
CAS NO.：61438-64-0
Empirical Formula: C22H13Cl2I2N2NaO2
Molecular Weight: 685.06
MDL number: MFCD03427328
EINECS: 262-794-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB364.00 | In Stock |
|
| 100G | RMB1063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >230°C (dec.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C22H14Cl2I2N2O2.Na.H/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29;;/h2-9,17,29H,1H3,(H,28,30);; |
| InChIKey | OEGFIKHJXKPQEL-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(Cl)=CC=1)(C1C=C(C)C(NC(C2C=C(I)C=C(I)C=2O)=O)=CC=1Cl)C#N.[NaH] |
Description and Uses
As a broad-spectrum anthelmintic, Closantel sodium can be used against nematode infection.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 29269090 |
