A7998112
Tris(trimethylsilyl) Borate , >98.0%(GC) , 4325-85-3
CAS NO.：4325-85-3
Empirical Formula: C9H27BO3Si3
Molecular Weight: 278.38
MDL number: MFCD00051588
EINECS: 629-367-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB148.80 | In Stock |
|
| 100G | RMB474.40 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -35°C |
| Boiling point: | 186 °C (lit.) |
| Density | 0.831 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 109 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| Specific Gravity | 0.828 |
| color | Clear colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1772733 |
| InChI | InChI=1S/C9H27BO3Si3/c1-14(2,3)11-10(12-15(4,5)6)13-16(7,8)9/h1-9H3 |
| InChIKey | YZYKZHPNRDIPFA-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)OB(O[Si](C)(C)C)O[Si](C)(C)C |
| CAS DataBase Reference | 4325-85-3 |
| EPA Substance Registry System | Silanol, trimethyl-, triester with boric acid (H3BO3) (4325-85-3) |
Description and Uses
Tris(trimethylsilyl) borate is used as intermediate of organic synthesis and additive of lithium battery electrolyte.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
