A7923712
Tri-<i>tert</i>-butyl 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetate , >93.0%(N) , 122555-91-3
CAS NO.：122555-91-3
Empirical Formula: C26H50N4O6
Molecular Weight: 514.7
MDL number: MFCD05865261
EINECS: 635-018-3
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB164.80 | In Stock |
|
| 1g | RMB236.80 | In Stock |
|
| 5g | RMB796.80 | In Stock |
|
| 25g | RMB2492.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183℃ |
| Boiling point: | 561.6±50.0 °C(Predicted) |
| Density | 1.022 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Low-Melting Solid |
| pka | 9.57±0.20(Predicted) |
| color | White to Off-White |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C26H50N4O6/c1-24(2,3)34-21(31)18-28-12-10-27-11-13-29(19-22(32)35-25(4,5)6)15-17-30(16-14-28)20-23(33)36-26(7,8)9/h27H,10-20H2,1-9H3 |
| InChIKey | NMHVTLJFPDOJOD-UHFFFAOYSA-N |
| SMILES | N1(CC(OC(C)(C)C)=O)CCNCCN(CC(OC(C)(C)C)=O)CCN(CC(OC(C)(C)C)=O)CC1 |
Description and Uses
Tri-tert-butyl 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetate with amide ligands bearing positively charged terbium complexes are used for sensitive detection of NADPH-dependent enzyme activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29339900 |
