A7849112
trans-1,4-Diaminocyclohexane , >98.0%(GC) , 2615-25-0
Synonym(s):
trans-1,4-Cyclohexanediamine
CAS NO.：2615-25-0
Empirical Formula: C6H14N2
Molecular Weight: 114.19
MDL number: MFCD00075174
EINECS: 640-403-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100G | RMB523.20 | In Stock |
|
| 500G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-72 °C |
| Boiling point: | 197 °C(lit.) |
| Density | 0.939±0.06 g/cm3(Predicted) |
| vapor pressure | 18 mm Hg ( 87.2 °C) |
| Flash point: | 71 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 10.78±0.70(Predicted) |
| form | Crystals or Chunks |
| color | Off-white to brown |
| explosive limit | 6% |
| BRN | 2801657 |
| InChI | InChI=1S/C6H14N2/c7-5-1-2-6(8)4-3-5/h5-6H,1-4,7-8H2/t5-,6- |
| InChIKey | VKIRRGRTJUUZHS-IZLXSQMJSA-N |
| SMILES | [C@@H]1(N)CC[C@@H](N)CC1 |
Description and Uses
trans-1,4-Diaminocyclohexane was used in preparation of fully aliphatic polyimides. It was employed as the structure-directing agent in the synthesis of novel two-dimensional layered zinc phosphate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34-20/21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 2 |
| WGK Germany | 2 |
| F | 10-34 |
| Autoignition Temperature | 680 °F |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29213000 |
