A7799112
2,3,4-Trifluorobenzoic acid , 98% , 61079-72-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB142.40 | In Stock |
|
| 100G | RMB431.20 | In Stock |
|
| 500g | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-142 °C (lit.) |
| Boiling point: | 245.3±35.0 °C(Predicted) |
| Density | 1,404g/cm |
| refractive index | 1,482 |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| pka | 2.87±0.10(Predicted) |
| form | Solid |
| color | White |
| BRN | 7476020 |
| InChI | InChI=1S/C7H3F3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12) |
| InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1F |
Description and Uses
2,3,4-Trifluorobenzoic Acid is used in the preparation of benzamide derivatives with potential anti-cancer properties. It is also used in the preparation of polyfluoroaryl oxazoline compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
