A7787612
Trimethoxy(1H,1H,2H,2H-heptadecafluorodecyl)silane , 98% , 83048-65-1
CAS NO.：83048-65-1
Empirical Formula: C13H13F17O3Si
Molecular Weight: 568.3
MDL number: MFCD07368748
EINECS: 617-434-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB148.00 | In Stock |
|
| 100G | RMB514.40 | In Stock |
|
| 500g | RMB2384.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 247°C |
| Density | 1,54 g/cm3 |
| refractive index | 1.33125 |
| Flash point: | >65°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.54 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C13H13F17O3Si/c1-31-34(32-2,33-3)5-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4-5H2,1-3H3 |
| InChIKey | HJIMAFKWSKZMBK-UHFFFAOYSA-N |
| SMILES | [Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OC)(OC)OC |
| LogP | 7.280 (est) |
| EPA Substance Registry System | Silane, (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)trimethoxy- (83048-65-1) |
Description and Uses
Trimethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane (CAS# 83048-65-1) has been used in the preparation of abrasion resistant super-antiwetting nylon surfaces. As an additive, Trimethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane is used to increase the hydrophobicity of the surfaces of carbon nanotube structures.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3265 8 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | No |
| HS Code | 29420000 |
