A7787012
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl methacrylate , 98%, MEHQ stabilizer containing 225ppm , 2144-53-8
Synonym(s):
1H,1H,2H,2H-perfluorooctyl methacrylate
CAS NO.：2144-53-8
Empirical Formula: C12H9F13O2
Molecular Weight: 432.18
MDL number: MFCD00077580
EINECS: 218-407-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB324.80 | In Stock |
|
| 100G | RMB663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92 °C8 mm Hg(lit.) |
| Density | 1.496 g/mL at 25 °C(lit.) |
| vapor pressure | 8.6Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.496 |
| Water Solubility | 42μg/L at 20℃ |
| InChI | InChI=1S/C12H9F13O2/c1-5(2)6(26)27-4-3-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h1,3-4H2,2H3 |
| InChIKey | CDXFIRXEAJABAZ-UHFFFAOYSA-N |
| SMILES | C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(=O)C(C)=C |
| LogP | 5.2 at 23℃ |
Description and Uses
Surface structure and outer group orientation in poly(perfluoroalkylethyl methacrylate) consist of Tridecafluorohexylethyl Methacrylate.Semifluorinated diblock copolymers based on Me methacrylate and Tridecafluorohexylethyl Methacrylate were prepared by nucleophilic catalyzed group transfer polymerization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UD3580000 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29161290 |
