A7755012
Tri(p-tolyl)phosphine , 98% , 1038-95-5
Synonym(s):
TPTP
CAS NO.：1038-95-5
Empirical Formula: C21H21P
Molecular Weight: 304.37
MDL number: MFCD00008542
EINECS: 213-863-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB18.40 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 100G | RMB314.40 | In Stock |
|
| 500g | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-148 °C(lit.) |
| Boiling point: | 399.8±41.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to light yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 651045 |
| InChI | InChI=1S/C21H21P/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | WXAZIUYTQHYBFW-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
| CAS DataBase Reference | 1038-95-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphine, tris(4-methylphenyl)- (1038-95-5) |
Description and Uses
Tri(p-tolyl)phosphine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | SZ3880000 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29319090 |
