A7720912
Tebufenozide , Analysis standard product, 99% , 112410-23-8
CAS NO.：112410-23-8
Empirical Formula: C22H28N2O2
Molecular Weight: 352.47
MDL number: MFCD00467963
EINECS: 412-850-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191°; mp 186-188° (Sundaram, 1081) |
| Density | 1.074±0.06 g/cm3(Predicted) |
| vapor pressure | 3 x 10 -6 Pa (25 °C) |
| storage temp. | 0-6°C |
| solubility | Chloroform: Slightly Soluble,Methanol: Slightly Soluble |
| pka | 10.89±0.46(Predicted) |
| Water Solubility | 0.83 mg l-1 (20 °C) |
| form | Solid |
| color | White to off-white |
| BRN | 7822297 |
| InChI | InChI=1S/C22H28N2O2/c1-7-17-8-10-18(11-9-17)20(25)23-24(22(4,5)6)21(26)19-13-15(2)12-16(3)14-19/h8-14H,7H2,1-6H3,(H,23,25) |
| InChIKey | QYPNKSZPJQQLRK-UHFFFAOYSA-N |
| SMILES | C(N(C(C)(C)C)NC(=O)C1=CC=C(CC)C=C1)(=O)C1=CC(C)=CC(C)=C1 |
| LogP | 4.240 (est) |
Description and Uses
Synthetic nonsteroidal ecdysone agonist causing premature molting; novel insect growth regulator specific to lepidopteran species. Insecticide.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Danger |
| Hazard statements | H411 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29280000 |
| Toxicity | LD50 orally in rats, mice: >5000 mg/kg; dermally in rats: >5000 mg/kg; LD50 in honey bees (96 hr, contact): >234 mg/bee; LC50 in mallard duck (8-day dietary): >5000 mg/kg; LC50 in rainbow trout (96 hr): 5.7 mg/l (Heller) |
