A7719812
Triethyloxonium tetrafluoroborate , 1.0Minmethylenechloride , 368-39-8
CAS NO.：368-39-8
Empirical Formula: C6H15BF4O
Molecular Weight: 189.99
MDL number: MFCD00044423
EINECS: 206-705-1
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB190.40 | In Stock |
|
| 100ML | RMB527.20 | In Stock |
|
| 500ML | RMB2135.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-97°C |
| Density | 1.328 g/mL at 25 °C |
| storage temp. | 2-8°C |
| solubility | methylene chloride: 20 mg/mL, clear, colorless |
| form | Powder |
| color | White |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| Merck | 14,5796 |
| BRN | 3598090 |
| Exposure limits | ACGIH: TWA 50 ppm OSHA: TWA 25 ppm; STEL 125 ppm NIOSH: IDLH 2300 ppm |
| InChI | InChI=1S/C6H15O.BF4/c1-4-7(5-2)6-3;2-1(3,4)5/h4-6H2,1-3H3;/q+1;-1 |
| InChIKey | IYDQMLLDOVRSJJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.[O+](CC)(CC)CC |
Description and Uses
Triethyloxonium tetrafluoroborate is used as a powerful alkylating agent, especially for ethylation. It is used for the modification of carboxyl residues in proteins. It is involved in the preparation of μ-amino esters from lactams. It is also alkylating agent for nucleophilic functional groups in organic synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-40-14-67-37 |
| Safety Statements | 23-24/25-26-36/37/39-45-22 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 2 |
| RTECS | RR4584700 |
| F | 3-10-16-21 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29420000 |
| Toxicity | dnd-smc 500 mmol/L CPBTAL 23,2485,75 |
