A7705812
5,6,7,8-Tetrahydroquinoline , 98% , 10500-57-9
CAS NO.：10500-57-9
Empirical Formula: C9H11N
Molecular Weight: 133.19
MDL number: MFCD00006734
EINECS: 234-030-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 10ML | RMB28.80 | In Stock |
|
| 25ML | RMB44.00 | In Stock |
|
| 50ML | RMB79.20 | In Stock |
|
| 100ML | RMB151.20 | In Stock |
|
| 500ml | RMB676.80 | In Stock |
|
| 1L | RMB1200.00 | In Stock |
|
| 2.5L | RMB2639.20 | In Stock |
|
| 5L | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 238°C |
| Density | 1,08 g/cm3 |
| refractive index | 1.5420 to 1.5450 |
| Flash point: | 90°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Sparingly) Methanol (Slightly) |
| form | Oil |
| pka | 6.30±0.20(Predicted) |
| color | Colourless |
| Specific Gravity | 1.0341.0304 (20/4℃) |
| InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h3,5,7H,1-2,4,6H2 |
| InChIKey | YQDGQEKUTLYWJU-UHFFFAOYSA-N |
| SMILES | N1C2=C(CCCC2)C=CC=1 |
| CAS DataBase Reference | 10500-57-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 5,6,7,8-tetrahydro-(10500-57-9) |
Description and Uses
5,6,7,8-Tetrahydroquinoline can be used to prevent and treat of hyperlipemia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H412 |
| Precautionary statements | P280-P301+P310-P261 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-37/39 |
| HS Code | 29334900 |
