A7705212
2,3,4,6-Tetra-O-benzyl-D-galactose , 98% , 53081-25-7
CAS NO.：53081-25-7
Empirical Formula: C34H36O6
Molecular Weight: 540.65
MDL number: MFCD00132927
EINECS: 610-955-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB111.20 | In Stock |
|
| 1G | RMB232.80 | In Stock |
|
| 5G | RMB782.40 | In Stock |
|
| 25g | RMB2142.40 | In Stock |
|
| 100g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C |
| Boiling point: | 576.06°C (rough estimate) |
| Density | 1.0726 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMF (Sparingly) |
| pka | 13.33±0.20(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| optical activity | α25D +11±2, c = 1 in CHCl3 ; α20D +10.5±2, c = 1 in CHCl3 |
| Water Solubility | Insoluble in water. |
| Stability: | Store in freezer |
| InChIKey | OGOMAWHSXRDAKZ-BJPULKCASA-N |
| SMILES | [C@@]([H])(OCC1C=CC=CC=1)([C@H](C=O)OCC1C=CC=CC=1)[C@@H](OCC1C=CC=CC=1)[C@H](O)COCC1C=CC=CC=1 |&1:0,10,21,30,r| |
Description and Uses
2,3,4,6-Tetra-O-benzyl-D-galactopyranose is a protected carbohydrate derivative, precisely a benzylated form of D-galactopyranose. This compound is often used in organic synthesis, particularly in preparing glycosyl donors and other carbohydrate derivatives. The benzyl groups serve as protecting groups, which can be removed under specific conditions to yield the free sugar.
2,3,4,6-Tetra-O-benzyl-D-galactopyranose (cas# 53081-25-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29329990 |
