A7702212
6-(Trifluoromethyl)nicotinic acid , 97% , 231291-22-8
Synonym(s):
6-(Trifluoromethyl)nicotinic acid
CAS NO.：231291-22-8
Empirical Formula: C7H4F3NO2
Molecular Weight: 191.11
MDL number: MFCD00792430
EINECS: 624-411-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB32.00 | In Stock |
|
| 5g | RMB116.80 | In Stock |
|
| 25g | RMB459.20 | In Stock |
|
| 100g | RMB1495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-197 °C(lit.) |
| Boiling point: | 259.3±40.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.96±0.10(Predicted) |
| color | Pale Beige to Light Brown |
| InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-2-1-4(3-11-5)6(12)13/h1-3H,(H,12,13) |
| InChIKey | JNYLMODTPLSLIF-UHFFFAOYSA-N |
| SMILES | C1=NC(C(F)(F)F)=CC=C1C(O)=O |
Description and Uses
6-Trifluoromethyl Nicotinic Acid can be prepared to use Raf inhibitors to treat cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
