A7648712
4′-tert-Butyl-4-chlorobutyrophenone , 98% , 43076-61-5
CAS NO.：43076-61-5
Empirical Formula: C14H19ClO
Molecular Weight: 238.75
MDL number: MFCD00018996
EINECS: 256-077-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB104.00 | In Stock |
|
| 100G | RMB352.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-49 °C(lit.) |
| Boiling point: | 152 °C (1 mmHg) |
| Density | 1.0292 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| Flash point: | 152-155°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 780343 |
| InChI | InChI=1S/C14H19ClO/c1-14(2,3)12-8-6-11(7-9-12)13(16)5-4-10-15/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | RLKSQLJFGCDUOX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C(C)(C)C)C=C1)(=O)CCCCl |
| CAS DataBase Reference | 43076-61-5(CAS DataBase Reference) |
Description and Uses
1-(4-tert-Butylphenyl)-4-chloro-1-butanone, is the starting material in the synthesis of Terfenadine (T114500).
Safety
| Symbol(GHS) |    GHS05,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H302-H317-H318-H411 |
| Precautionary statements | P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P273-P280-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-43-51/53 |
| Safety Statements | 26-36/37/39-61-7/8-24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HS Code | 2914790090 |
