A7634312
4-(Trifluoromethyl)benzyl alcohol , 98% , 349-95-1
CAS NO.：349-95-1
Empirical Formula: C8H7F3O
Molecular Weight: 176.14
MDL number: MFCD00004661
EINECS: 206-494-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22-25 °C |
| Boiling point: | 78-80 °C/4 mmHg (lit.) |
| Density | 1.286 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 213 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 13.91±0.10(Predicted) |
| form | Liquid After Melting |
| Specific Gravity | 1.286 |
| color | Clear colorless to light brown |
| Water Solubility | Soluble in water. |
| BRN | 1450174 |
| InChI | InChI=1S/C8H7F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-4,12H,5H2 |
| InChIKey | MOOUWXDQAUXZRG-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(C(F)(F)F)C=C1 |
Description and Uses
4-(Trifluoromethyl)benzyl alcohol, is used as a pharmaceutical intermediate, it is also used to predict the NMR spectrum. 4-(Trifluoromethyl)benzyl alcohol is employed as a reagent in, for example, kinetic studies of phosphonoformate prodrugs and aquachromium(IV).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| HazardClass | CORROSIVE |
| HS Code | 29062900 |
