PRODUCT Properties
| Melting point: | 140°C |
| Boiling point: | 244.08°C (rough estimate) |
| alpha | D25 +11.5° (c = 6.5) |
| Density | 1.1740 (rough estimate) |
| refractive index | 1.4496 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Water: 50 mg/mL (378.33 mM); DMSO: < 1 mg/mL (insoluble or slightly soluble) |
| pka | 1.705(at 25℃) |
| form | Solid |
| color | White to off-white |
| PH | 9.70 |
| optical activity | +12.125 (H2O) +28.425 (5 mol dm-3 HCl) |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | AHLPHDHHMVZTML-BYPYZUCNSA-N |
| SMILES | C(O)(=O)[C@H](CCCN)N |
| LogP | -4.220 |
| CAS DataBase Reference | 70-26-8(CAS DataBase Reference) |
| EPA Substance Registry System | L-Ornithine (70-26-8) |
Description and Uses
hepatoprotectant, anticholesteremic
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Toxicity | sce-hmn-lym 10 mg/L MUREAV 372,75,1996 |
