A7422012
Sodium Methanesulfinate , >90.0%(T) , 20277-69-4
Synonym(s):
Methanesulfinic acid sodium salt
CAS NO.：20277-69-4
Empirical Formula: CH5NaO2S
Molecular Weight: 104.1
MDL number: MFCD00040392
EINECS: 243-669-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 10g | RMB47.20 | In Stock |
|
| 25G | RMB50.40 | In Stock |
|
| 100G | RMB156.00 | In Stock |
|
| 500g | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-226 °C (dec.) (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol, Water (Slightly) |
| form | Powder |
| color | White to light beige |
| Water Solubility | soluble |
| Sensitive | Air Sensitive & Hygroscopic |
| BRN | 3565430 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/CH4O2S.Na.H/c1-4(2)3;;/h1H3,(H,2,3);; |
| InChIKey | LYPGDCWPTHTUDO-UHFFFAOYSA-M |
| SMILES | S(O)(=O)C.[NaH] |
Description and Uses
Sodium methylsulfinate can be used to synthesize cyclooxygenase-2 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-20/21/22 |
| Safety Statements | 36/37-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29309090 |
