A7346112
Sulfadimethoxine , 98% , 122-11-2
Synonym(s):
4-Amino-N-(2,6-dimethoxy-4-pyrimidinyl)benzenesulfonamide;Sulfadimethoxine
CAS NO.：122-11-2
Empirical Formula: C12H14N4O4S
Molecular Weight: 310.33
MDL number: MFCD00057345
EINECS: 204-523-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25G | RMB371.20 | In Stock |
|
| 100g | RMB1000.00 | In Stock |
|
| 1KG | RMB7679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| Boiling point: | 265.5°C (rough estimate) |
| Density | 1.4006 (rough estimate) |
| refractive index | 1.6270 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | NH4OH 1 M: 50 mg/mL, clear, faintly yellow |
| pka | pKa 5.94(H2O
t = 25.0±0.5
I = 0.2) (Uncertain) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 46.3mg/L(37 ºC) |
| Merck | 14,8905 |
| BRN | 306856 |
| InChI | InChI=1S/C12H14N4O4S/c1-19-11-7-10(14-12(15-11)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ZZORFUFYDOWNEF-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C=C(OC)N=C(OC)N=2)(=O)=O)=CC=C(N)C=C1 |
Description and Uses
Antibacterial.This compound is a contaminant of emerging concern (CECs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37-24/25-23 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | WO9030000 |
| F | 8 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29350090 |
| Toxicity | LD50 orally in mice: >10 g/kg (Seki) |
