A7265427
3-Chlorobenzyl chloride , 98% , 620-20-2
Synonym(s):
3,α-Dichlorotoluene
CAS NO.：620-20-2
Empirical Formula: C7H6Cl2
Molecular Weight: 161.03
MDL number: MFCD00000905
EINECS: 210-629-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB87.20 | In Stock |
|
| 500G | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3.27°C (estimate) |
| Boiling point: | 215-216 °C (lit.) |
| Density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 210 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Sensitive | Lachrymatory |
| BRN | 742266 |
| InChI | InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | DDGRAFHHXYIQQR-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(CCl)=C1 |
Description and Uses
3-Chlorobenzyl chloride has been used in the reaction of 3-methoxybenzyl chloride and ethyl 4-bromobenzoate in pure water, using zinc dust and a Pd catalyst.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,N,Xn |
| Risk Statements | 34-51/53-43-36-20/21/22 |
| Safety Statements | 26-36/37/39-45-61-14C |
| RIDADR | UN 2235 6.1/PG 3 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
