A7099812
4-Quinolinecarboxaldehyde , 97% , 4363-93-3
Synonym(s):
Cinchoninaldehyde
CAS NO.：4363-93-3
Empirical Formula: C10H7NO
Molecular Weight: 157.17
MDL number: MFCD00006781
EINECS: 224-453-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB984.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-52 °C (lit.) |
| Boiling point: | 131-133°C 5mm |
| Density | 1.1599 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder, Chunks, or Solid |
| pka | 2.95±0.13(Predicted) |
| color | Off-white to yellow-brown |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 113072 |
| InChI | InChI=1S/C10H7NO/c12-7-8-5-6-11-10-4-2-1-3-9(8)10/h1-7H |
| InChIKey | MGCGJBXTNWUHQE-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C=O)=CC=1 |
Description and Uses
4-Quinolinecarboxaldehyde was used in the synthesis of lepidylamines. It also shows antimicrobial activity toward human intestinal bacteria such as Clostridium perfringens.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-36/37/38 |
| Safety Statements | 24/25-36-26-36/37/39 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
