A7098358
4-Butylresorcinol , 10mMinDMSO , 18979-61-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50.0 to 55.0 °C |
| Boiling point: | 166°C/7mmHg(lit.) |
| Density | 1.092±0.06 g/cm3(Predicted) |
| vapor pressure | 0.041Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO : 150 mg/mL (902.42 mM) |
| form | Powder |
| pka | 9.95±0.18(Predicted) |
| color | white to pale yellow powder |
| Odor | Characteristic |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3 |
| InChIKey | CSHZYWUPJWVTMQ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCCC)C(O)=C1 |
| LogP | 2.8 at 24℃ and pH7 |
| Surface tension | 17.8mN/m at 1g/L and 20℃ |
Description and Uses
4-n-butylresorcinol is a derivative of resorcinol and a potent human tyrosinase inhibitor. It may be used to decrease skin irritation and is also known to inhibit melanin production.
4-Butylresorcinol is considered a potential Cytochrome P450 inhibitor. It can cause hypopigmentation due to its direct inhibition of tyrosinase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| RTECS | VH0420000 |
| HS Code | 2907290090 |
