A7097112
Quinine sulfate dihydrate , 98% , 6119-70-6
CAS NO.：6119-70-6
Empirical Formula: C20H26N2O6S
Molecular Weight: 422.5
MDL number: MFCD00150790
EINECS: 639-128-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~225 °C (dec.)(lit.) |
| alpha | -245 º (c=2, 0.1M HCl) |
| FEMA | 2977 | QUININE SULFATE |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Soluble in a mixture of chloroform and absolute alcohol (2:1). |
| form | Crystalline Powder |
| color | Light yellow or beige to brown |
| Odor | odorless |
| Odor Type | odorless |
| Water Solubility | 0.12 g/100 mL (20 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,8061 |
| BRN | 6113937 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkalies, ammonia, strong bases, iodine. |
| InChIKey | AKYHKWQPZHDOBW-QJLYHTAINA-N |
| SMILES | [C@H]([C@]1([H])C[C@@H]2CC[N@]1C[C@@H]2C=C)(C1=CC=NC2=CC=C(OC)C=C12)O.S(O)(O)(=O)=O |&1:0,1,4,7,9,r| |
| LogP | 3.44 |
Description and Uses
Primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-42/43-22-36/38 |
| Safety Statements | 26-45-37-24-37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | VA8440000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29392000 |
