PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Freely soluble in water and in dimethylformamide, practically insoluble in acetone and in anhydrous methanol. |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C9H8O4.CH4N2O.Ca.2H/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;2-1(3)4;;;/h2-5H,1H3,(H,11,12);(H4,2,3,4);;; |
| InChIKey | BMMIBWSFPSYDEH-UHFFFAOYSA-N |
| SMILES | C(=O)(N)N.C(C1C=CC=CC=1OC(=O)C)(=O)O.[Ca] |
| CAS DataBase Reference | 5749-67-7 |
Description and Uses
Carbasalate calcium is a calcium-urea chelate of aspirin that has analgesic, anti-inflammatory, and antipyretic effects. It reduces carrageenan-induced paw edema in rats.
Salicylate; non-selective cyclo-oxygenase inhibitor; antipyretic; analgesic; antiinflammatory.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
