A6971058
Citicolinesodiumsalthydrate , 10mMinWater , 33818-15-4
Synonym(s):
CDP-choline-Na;CDP-coline;Citicoline sodium;P′-[2-(Trimethylammonio)-ethyl]-ester cytidine 5′-(tri-hydro-gen di-phos-phate) inner salt monosodium
CAS NO.：33818-15-4
Empirical Formula: C14H27N4NaO11P2
Molecular Weight: 512.32
MDL number: MFCD00037486
EINECS: 251-689-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-268°C (dec.) |
| alpha | D20 +12.5° (c = 1.0 in H2O) |
| storage temp. | -20°C |
| solubility | H2O: 100mg/mL |
| form | solid |
| color | white |
| Water Solubility | Soluble in water (100 mg/ml). |
| λmax | 280nm(HCl aq.)(lit.) |
| Merck | 13,2343 |
| BRN | 4110040 |
| InChIKey | YWAFNFGRBBBSPD-OCMLZEEQSA-M |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP([O-])(=O)OCC[N+](C)(C)C)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH] |&1:1,2,3,21,r| |
| CAS DataBase Reference | 33818-15-4 |
Description and Uses
Cytidine-5'-diphosphocholine sodium salt hydrate acts as a neuroprotective agent in situations of hypoxia and ischemia. It is used as biosynthetic intermediate of membrane phospholipids. It is a cerebral vasodilator and inhibits PLA2 activation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29349990 |
