PRODUCT Properties
| Melting point: | 111° |
| Boiling point: | 353.09°C (rough estimate) |
| Density | 1.4406 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform[soluble in] |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | Orange-colored prisms from butyl acetate |
| Odor | very bitter taste |
| InChI | InChI=1S/C10H8OS3/c1-11-8-4-2-7(3-5-8)9-6-10(12)14-13-9/h2-6H,1H3 |
| InChIKey | KYLIZBIRMBGUOP-UHFFFAOYSA-N |
| SMILES | S1C(C2=CC=C(OC)C=C2)=CC(=S)S1 |
Description and Uses
Anethole trithione is a choleretic drug that can be effective in the treatment of dry mouth, including drug-induced xerostomia. Research suggests that Anethole trithione may exert its therapeutic effects by acting on the alpha-CGRP nerves in the salivary glands, which in turn promotes salivary secretion[1-2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2934.99.3000 |
| Toxicity | LD50 orl-mus: 3850 mg/kg NIIRDN 6,25,82 |
