A6833312
(4-Pyridyl)acetone , >98.0%(GC) , 6304-16-1
CAS NO.：6304-16-1
Empirical Formula: C8H9NO
Molecular Weight: 135.16
MDL number: MFCD00129043
EINECS: 228-605-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100G | RMB711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13°C |
| Boiling point: | 143°C 20mm |
| Density | 1.046±0.06 g/cm3(Predicted) |
| refractive index | 1.5225 |
| Flash point: | 143°C/20mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 4.90±0.10(Predicted) |
| color | Light Brown to Brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 110960 |
| InChI | InChI=1S/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
| InChIKey | ILRVKOYYFFNXDB-UHFFFAOYSA-N |
| SMILES | C(C1C=CN=CC=1)C(=O)C |
| CAS DataBase Reference | 6304-16-1(CAS DataBase Reference) |
Description and Uses
(4-Pyridyl)acetone is a reactant in the synthesis of Milrinone (M344680), a selective phosphodiesterase inhibitor with vasodilating and positive inotropic activity. Cardiotonic.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| HS Code | 29337900 |
