A6827912
5-Phenyl-1H-tetrazole , 99% , 18039-42-4
CAS NO.：18039-42-4
Empirical Formula: C7H6N4
Molecular Weight: 146.15
MDL number: MFCD01451271
EINECS: 241-950-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB131.20 | In Stock |
|
| 500G | RMB491.20 | In Stock |
|
| 2.5kg | RMB1814.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216 °C (dec.)(lit.) |
| Boiling point: | 255.75°C (rough estimate) |
| Density | 1.2955 (rough estimate) |
| refractive index | 1.6530 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.28±0.10(Predicted) |
| color | White to almost white |
| InChI | InChI=1S/C7H6N4/c1-2-4-6(5-3-1)7-8-10-11-9-7/h1-5H,(H,8,9,10,11) |
| InChIKey | MARUHZGHZWCEQU-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2)N=NN1 |
Description and Uses
5-Phenyl-1H-tetrazole may be used as ligand in the solvothermal synthesis of 3D polyoxometalate-based silver coordination polymers. It was used in the synthesis of 5-phenyltetrazolate organolanthanide complexes. It was used to investigate the corrosion inhibition of copper in salt water.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280h-P305+P351+P338 |
| Hazard Codes | Xn,Xi,F |
| Risk Statements | 22-44-11-36/37/38 |
| Safety Statements | 36-37/39-26-16 |
| RIDADR | UN 1325 4.1/PG III |
| WGK Germany | 3 |
| RTECS | XF7538750 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29339900 |
| Toxicity | mouse,LD50,oral,890mg/kg (890mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLDLUNGS, THORAX, OR RESPIRATION: DYSPNEA,National Technical Information Service. Vol. OTS0570992, |
