A6784112
Pentadecafluorotriethylamine , 90% , 359-70-6
CAS NO.：359-70-6
Empirical Formula: C6F15N
Molecular Weight: 371.05
MDL number: MFCD00166270
EINECS: 206-632-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB108.80 | In Stock |
|
| 25G | RMB280.00 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -116.95°C |
| Boiling point: | 68-69 °C743 mm Hg(lit.) |
| Density | 1.736 g/mL at 25 °C(lit.) |
| vapor pressure | 2.15 psi ( 20 °C) |
| refractive index | n |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -27.46±0.50(Predicted) |
| form | liquid |
| Specific Gravity | 1.736 |
| color | clear colourless |
| InChI | InChI=1S/C6F15N/c7-1(8,9)4(16,17)22(5(18,19)2(10,11)12)6(20,21)3(13,14)15 |
| InChIKey | CBEFDCMSEZEGCX-UHFFFAOYSA-N |
| SMILES | C(N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)(F)(F)C(F)(F)F |
Description and Uses
Perfluorotriethylamine is used for toxicity test, cytotoxicity, genotoxicity and pyrolysis experiments.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3267 8/PG III |
| WGK Germany | 3 |
| RTECS | KH2155170 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29211990 |
