A6770012
1H,1H,2H,2H-Perfluoro-1-decanol , 97% , 678-39-7
Synonym(s):
1H,1H,2H,2H-Heptadecafluoro-n-decanol;1H,1H,2H,2H-Perfluoro-1-decanol;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decanol
CAS NO.：678-39-7
Empirical Formula: C10H5F17O
Molecular Weight: 464.12
MDL number: MFCD00039544
EINECS: 211-648-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB203.20 | In Stock |
|
| 100G | RMB688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50 °C |
| Boiling point: | 113°C 10mm |
| Density | 1.633±0.06 g/cm3(Predicted) |
| Flash point: | None |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform and methanol. |
| form | solid |
| pka | 14.28±0.10(Predicted) |
| color | tan |
| BRN | 2227487 |
| InChI | InChI=1S/C10H5F17O/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h28H,1-2H2 |
| InChIKey | JJUBFBTUBACDHW-UHFFFAOYSA-N |
| SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Description and Uses
1H,1H,2H,2H-Perfluoro-1-decanol (8:2 FTOH) may be used in the preparation of 8:2 FTOH sulfate and 8:2 FTOH glucuronide.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H351-H360D-H362-H372 |
| Precautionary statements | P260-P263-P280-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29055900 |
