A6721512
2,6-Pyridinedicarbonyl chloride , 96% , 3739-94-4
Synonym(s):
2,6-Pyridinedicarbonyl chloride;Pyridine-2,6-dicarboxylic acid chloride
CAS NO.：3739-94-4
Empirical Formula: C7H3Cl2NO2
Molecular Weight: 204.01
MDL number: MFCD00006289
EINECS: 223-125-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| 100G | RMB2063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-58 °C (lit.) |
| Boiling point: | 284 °C (lit.) |
| Density | 1.4521 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | 284°C |
| pka | -2.12±0.10(Predicted) |
| form | Crystalline Powder, Crystals or Chunks |
| color | White to brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 131556 |
| InChI | InChI=1S/C7H3Cl2NO2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H |
| InChIKey | GWHOGODUVLQCEB-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=O)=NC(C(Cl)=O)=CC=C1 |
| CAS DataBase Reference | 3739-94-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Pyridinedicarbony chloride(3739-94-4) |
Description and Uses
2,6-Pyridinedicarbonyl dichloride can be used as a starting material to synthesize:
- Pyridine-based polyamido-polyester optically active macrocycles by reacting with chiral diamine dihydrobromides.
- Pyridine-bridged 2,6-bis-carboxamide Schiff′s bases by treating with L-alanine or 2-methyl-alanine methyl esters.
- N,N′-bis(1-pyrenylmethyl)pyridine-2,6-dicarboxamide by reacting with 1-pyrenemethylamine hydrochloride in the presence of a base.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H317-H412 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P304+P340+P312 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29333990 |
