A6626812
Potassium trifluoromethanesulfonate , 98% , 2926-27-4
Synonym(s):
Potassium triflate;Trifluoromethanesulfonic acid potassium salt
CAS NO.：2926-27-4
Empirical Formula: CF3KO3S
Molecular Weight: 188.17
MDL number: MFCD00042370
EINECS: 207-009-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB51.20 | In Stock |
|
| 10G | RMB85.60 | In Stock |
|
| 25G | RMB168.00 | In Stock |
|
| 50G | RMB319.20 | In Stock |
|
| 100G | RMB456.80 | In Stock |
|
| 250G | RMB1015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238.5°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| color | White to Almost white |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 6: forms irreversible hydrate |
| BRN | 3727495 |
| InChI | InChI=1S/CHF3O3S.K/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
| InChIKey | GLGXXYFYZWQGEL-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S([O-])(=O)=O.[K+] |
Description and Uses
Potassium trifluoromethanesulfonate is used in studies of mixed alkali effects and short range interactions in poly(ethylene oxide) electrolytes,1 and characteristics of the electrochemical behavior of glassy carbon in super-acid media.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | No |
| HazardClass | CORROSIVE |
| HS Code | 29049090 |
