PRODUCT Properties
| Melting point: | 87-88 °C (lit.) |
| Boiling point: | 80°C 15mm |
| Density | 1.4296 (rough estimate) |
| refractive index | 1.367 |
| Flash point: | 80°C/15mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystals or Needles |
| color | White |
| Water Solubility | Insoluble in water. Solubility in toluene, almost transparent. |
| BRN | 1915630 |
| InChI | InChI=1S/C10F8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12 |
| InChIKey | JDCMOHAFGDQQJX-UHFFFAOYSA-N |
| SMILES | C1(F)=C2C(C(F)=C(F)C(F)=C2F)=C(F)C(F)=C1F |
Description and Uses
It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 9-29-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
