A6373312
Nitrosyl tetrafluoroborate , 95% , 14635-75-7
Synonym(s):
Nitrosonium tetrafluoroborate
CAS NO.：14635-75-7
Empirical Formula: BF4H2NO
Molecular Weight: 118.83
MDL number: MFCD00011433
EINECS: 238-679-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB236.80 | In Stock |
|
| 25G | RMB1005.60 | In Stock |
|
| 50G | RMB1727.20 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C |
| Boiling point: | 250°C 0,01mm |
| Density | 2.185 |
| Flash point: | 250°C/0.01mm subl. |
| storage temp. | 2-8°C |
| solubility | Soluble in acetonitrile. |
| form | Crystals or Crystalline Powder |
| Specific Gravity | 2.185 |
| color | White |
| Sensitive | Hygroscopic |
| Merck | 14,6649 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/BF4.H2NO/c2-1(3,4)5;1-2/h;1H2/q-1;+1 |
| InChIKey | CYLOZTYJBXHMJA-UHFFFAOYSA-N |
| SMILES | [NH2+]=O.[B+3]([F-])([F-])([F-])[F-] |
Description and Uses
Nitrosyl tetrafluoroborate is an efficient nitrosating and diazotizing agent. It reacts with alcohols and secondary amines to yield alkyl nitrites and nitrosamines, respectively. It reacts with primary amines to yield diazonium tetrafluoroborates. NOBF4 is also a mild oxidant and commonly used for single electron transfer oxidation.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 1-10 |
| Hazard Note | Corrosive/Hygroscopic (In Teflon Bottle ) |
| TSCA | T |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28402000 |
