A6325812
3-Nitro-<i>o</i>-cresol , 96% , 5460-31-1
Synonym(s):
2-Hydroxy-6-nitrotoluene;3-Nitro-o-cresol
CAS NO.：5460-31-1
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD00007241
EINECS: 226-739-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 10g | RMB96.00 | In Stock |
|
| 25G | RMB197.60 | In Stock |
|
| 100G | RMB673.60 | In Stock |
|
| 500g | RMB3279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148 °C (lit.) |
| Boiling point: | 147.0-152.0°C |
| Density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL |
| pka | 9.11±0.25(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| BRN | 1946057 |
| InChI | InChI=1S/C7H7NO3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3 |
| InChIKey | GAKLFAZBKQGUBO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 5460-31-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitro-o-cresol(5460-31-1) |
Description and Uses
2-Methyl-3-nitrophenol was used as internal standard to develop a method for measurement of stable isotope ratio of methylnitrophenols in atmospheric particulate matter.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-36/37/39-36-24/25 |
| RIDADR | UN 2446 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089000 |
