A6284612
2,6-Naphthalenedicarboxylic Acid , ≥98.0%(T) , 1141-38-4
CAS NO.：1141-38-4
Empirical Formula: C12H8O4
Molecular Weight: 216.19
MDL number: MFCD00004105
EINECS: 214-527-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB371.20 | In Stock |
|
| 100G | RMB1152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 316.6°C (rough estimate) |
| Density | 1.5 |
| refractive index | 1.7080 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in hot Pyridine |
| form | Powder |
| pka | 3.69±0.30(Predicted) |
| color | white |
| Water Solubility | 3μg/L at 20℃ |
| BRN | 2051257 |
| InChI | InChI=1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | RXOHFPCZGPKIRD-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(C(O)=O)C=C2)=CC=C1C(O)=O |
| LogP | 2.22 |
Description and Uses
2,6-Naphthalenedicarboxylic acid (H2ndc) can be used in the formation of metal-organic coordination polymers (MOCPs) for potential applications in various fields such as adsorption, separation, and magnetism. It can also be used as a monomer in the production of polyesters. H2ndc can also be used in the synthesis of a metal-organic framework (MOF), which can further be used as a drug carrier.
