A6256212
(4-Dimethylaminophenyl)di-tert-butylphosphine , ≥95% , 932710-63-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB344.80 | In Stock |
|
| 25g | RMB1472.00 | In Stock |
|
| 100g | RMB5714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-61°C |
| Boiling point: | 349.1±25.0 °C(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Acetone |
| form | crystal |
| pka | 4.73±0.24(Predicted) |
| color | white to light-brown |
| InChI | InChI=1S/C16H28NP/c1-15(2,3)18(16(4,5)6)14-11-9-13(10-12-14)17(7)8/h9-12H,1-8H3 |
| InChIKey | IQTHEAQKKVAXGV-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=C(P(C(C)(C)C)C(C)(C)C)C=C1 |
| CAS DataBase Reference | 932710-63-9 |
Description and Uses
Amphos can be used as an electrophotographic photoreceptor, process cartridge, and image forming electrode.
