A6197112
Nile Red , Used for fluorescence analysis, ≥95.0%(HPLC) , 7385-67-3
Synonym(s):
Nile Blue A Oxazone
CAS NO.：7385-67-3
Empirical Formula: C20H18N2O2
Molecular Weight: 318.37
MDL number: MFCD00011639
EINECS: 230-966-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB220.80 | In Stock |
|
| 1G | RMB636.00 | In Stock |
|
| 5G | RMB2463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205 °C(lit.) |
| Boiling point: | 457.53°C (rough estimate) |
| Density | 1.1871 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1mg/mL |
| form | Powder |
| pka | 4.08±0.20(Predicted) |
| color | Dark red to maroon |
| BRN | 279110 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C20H18N2O2/c1-3-22(4-2)13-9-10-16-18(11-13)24-19-12-17(23)14-7-5-6-8-15(14)20(19)21-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C(=O)C=C1C2=NC2=C(C=C(N(CC)CC)C=C2)O1 |
Description and Uses
Nile red is a lipophilic stain. It stains intracellular lipid droplets. Nile red is also intensely fluorescent, with a strong yellow-gold emission if included into a lipid-rich environment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29349990 |
