A6019912
2,2'-(5-Methyl-1,3-phenylene)bis(2-methylpropanenitrile) , 98% , 120511-72-0
CAS NO.：120511-72-0
Empirical Formula: C15H18N2
Molecular Weight: 226.32
MDL number: MFCD08062446
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB40.80 | In Stock |
|
| 1G | RMB101.60 | In Stock |
|
| 5g | RMB303.20 | In Stock |
|
| 25g | RMB1035.20 | In Stock |
|
| 100g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-130°C |
| Boiling point: | 339.1±32.0 °C(Predicted) |
| Density | 1.002±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C15H18N2/c1-11-6-12(14(2,3)9-16)8-13(7-11)15(4,5)10-17/h6-8H,1-5H3 |
| InChIKey | SJECEXNMZXMXNE-UHFFFAOYSA-N |
| SMILES | C1(=CC(C)=CC(C(C)(C)C#N)=C1)C(C)(C)C#N |
Description and Uses
An intermediate in the synthesis of Anastrozole (A637425), an aromatase inhibitor. Used as an antineoplastic.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2926900005 |
