A6008912
1-Methyl-4-(4-piperidino)piperazine , 98% , 53617-36-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB128.00 | In Stock |
|
| 5G | RMB431.20 | In Stock |
|
| 25G | RMB1563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-56°C |
| Boiling point: | 261℃ |
| Density | 0.992 |
| Flash point: | 114℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 10.27±0.10(Predicted) |
| form | solid |
| color | Pale yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C10H21N3/c1-12-6-8-13(9-7-12)10-2-4-11-5-3-10/h10-11H,2-9H2,1H3 |
| InChIKey | MRYYJGQKVGZGSB-UHFFFAOYSA-N |
| SMILES | N1(C)CCN(C2CCNCC2)CC1 |
| CAS DataBase Reference | 53617-36-0(CAS DataBase Reference) |
Description and Uses
It is used both as a reagent and building block in several synthetic applications. As intermediate. As an excellent catalyst for many condensation reactions.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318 |
| Precautionary statements | P280-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 2933399990 |
