A5851412
methyl 2-(4-bromophenyl)acetate , 97% , 41841-16-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100g | RMB286.40 | In Stock |
|
| 500g | RMB919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-114 °C |
| Boiling point: | 138-140 °C(Press: 13 Torr) |
| Density | 1.445±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Clear Colorless to Pale Yellow |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3 |
| InChIKey | QHJOWSXZDCTNQX-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 41841-16-1(CAS DataBase Reference) |
Description and Uses
Methyl 4-Bromophenylacetate (cas# 41841-16-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P261 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
