A5685012
2-Methyl-3-nitropyridine , >98.0%(GC) , 18699-87-1
CAS NO.：18699-87-1
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD04114137
EINECS: 805-108-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25g | RMB303.20 | In Stock |
|
| 100g | RMB1159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-33° |
| Boiling point: | 86°C/5mmHg(lit.) |
| Density | 1.246±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | 1.92±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C6H6N2O2/c1-5-6(8(9)10)3-2-4-7-5/h2-4H,1H3 |
| InChIKey | CCFGTKQIRWHYTB-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1[N+]([O-])=O |
Description and Uses
2-Methyl-3-nitropyridine is used as a starting reagent to synthesize 3-substituted-4 or 6-azaindoles, and is also used as a reagent to prepare 3-azaindolyl-4-arylmalemides (compounds that exhibit antiproliferative activity).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
