A5678312
<i>m</i>-Tolylacetic Acid , >98.0%(GC) , 621-36-3
Synonym(s):
3-Methylphenylacetic acid
CAS NO.：621-36-3
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD00004340
EINECS: 210-683-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5g | RMB159.20 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C(lit.) |
| Boiling point: | 231.72°C (rough estimate) |
| Density | 1.0858 (rough estimate) |
| refractive index | 1.5002 (estimate) |
| pka | 4.30±0.10(Predicted) |
| form | Shiny Flakes and Chunks |
| color | Colorless to off-white |
| Water Solubility | Soluble in water. |
| BRN | 2043549 |
| InChI | InChI=1S/C9H10O2/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | GJMPSRSMBJLKKB-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(C)=C1 |
Description and Uses
m-Tolylacetic acid is used as a reactant in the diastereoselective preparation of arylmethylene-isoindolinones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
