A5625512
3-Methyl-2(5<i>H</i>)-furanone , >97.0%(GC) , 22122-36-7
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB221.60 | In Stock |
|
| 5ML | RMB777.60 | In Stock |
|
| 25ML | RMB2721.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-73 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point: | 97-99 °C20 mm Hg(lit.) |
| Density | 1.13 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| BRN | 1642 |
| InChI | InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h2H,3H2,1H3 |
| InChIKey | VGHBEMPMIVEGJP-UHFFFAOYSA-N |
| SMILES | O1CC=C(C)C1=O |
| CAS DataBase Reference | 22122-36-7 |
Description and Uses
3-Methyl-2(5H)-furanone is the suitable model compound used to investigate the fragmentation mechanism of five membered lactones by electrospray ionisation tandem mass spectrometry and also to study the airway irritation of isoprene, isoprene/ozone, and isoprene/ozone/nitrogen dioxide mixture.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2932.20.5050 |
