A5589412
Methyl 6-Aminonicotinate , >98.0% , 36052-24-1
Synonym(s):
6-Aminonicotinic acid methyl ester;Methyl 2-amino-5-pyridinecarboxylate;Methyl 6-aminonicotinate
CAS NO.：36052-24-1
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD00797844
EINECS: 629-051-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB252.80 | In Stock |
|
| 100g | RMB827.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-162 °C (lit.) |
| Boiling point: | 304.5±22.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 4.78±0.13(Predicted) |
| form | Powder |
| color | White to light yellow-beige or pink |
| InChI | InChI=1S/C7H8N2O2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3,(H2,8,9) |
| InChIKey | JACPDLJUQLKABC-UHFFFAOYSA-N |
| SMILES | C1=NC(N)=CC=C1C(OC)=O |
| CAS DataBase Reference | 36052-24-1(CAS DataBase Reference) |
Description and Uses
Methyl 6-aminonicotinate can be used in ointments for treatment of psoriasis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
